C17H22F5N5O — CID 176644508
(1R)-3-[4-[(3,3-difluorocyclopentyl)amino]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol (PubChem CID 176644508) has the molecular formula C17H22F5N5O and a molecular weight of 407.39 g/mol. Its IUPAC name is (1R)-3-[4-[(3,3-difluorocyclopentyl)amino]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol.
| Compound Name | (1R)-3-[4-[(3,3-difluorocyclopentyl)amino]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 176644508 |
| Molecular Formula | C17H22F5N5O |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (1R)-3-[4-[(3,3-difluorocyclopentyl)amino]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol |
| SMILES | C[C@@H](Nc1nc(NC2CCC(F)(F)C2)nc(C2=C[C@H](O)CCC2)n1)C(F)(F)F |
| InChI | InChI=1S/C17H22F5N5O/c1-9(17(20,21)22)23-14-25-13(10-3-2-4-12(28)7-10)26-15(27-14)24-11-5-6-16(18,19)8-11/h7,9,11-12,28H,2-6,8H2,1H3,(H2,23,24,25,26,27)/t9-,11?,12-/m1/s1 |
| InChIKey | AJRXDRAYMTZVEU-WSXXKJPRSA-N |
| XLogP | 3.76 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |