C16H20F7N5O — CID 162445395
(1S)-2-fluoro-3-[4-(1,1,1-trifluoropropan-2-ylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohept-2-en-1-ol (PubChem CID 162445395) has the molecular formula C16H20F7N5O and a molecular weight of 431.36 g/mol. Its IUPAC name is (1S)-2-fluoro-3-[4-(1,1,1-trifluoropropan-2-ylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohept-2-en-1-ol.
| Compound Name | (1S)-2-fluoro-3-[4-(1,1,1-trifluoropropan-2-ylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohept-2-en-1-ol |
|---|---|
| PubChem CID | 162445395 |
| Molecular Formula | C16H20F7N5O |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (1S)-2-fluoro-3-[4-(1,1,1-trifluoropropan-2-ylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohept-2-en-1-ol |
| SMILES | CC(Nc1nc(N[C@H](C)C(F)(F)F)nc(C2=C(F)[C@@H](O)CCCC2)n1)C(F)(F)F |
| InChI | InChI=1S/C16H20F7N5O/c1-7(15(18,19)20)24-13-26-12(9-5-3-4-6-10(29)11(9)17)27-14(28-13)25-8(2)16(21,22)23/h7-8,10,29H,3-6H2,1-2H3,(H2,24,25,26,27,28)/t7-,8?,10+/m1/s1 |
| InChIKey | OMYNCLALIQIBMR-SHTILUHOSA-N |
| XLogP | 4.21 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |