C16H20F5N5O — CID 176644520
(1S)-3-[4-(cyclopropylmethylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol (PubChem CID 176644520) has the molecular formula C16H20F5N5O and a molecular weight of 393.36 g/mol. Its IUPAC name is (1S)-3-[4-(cyclopropylmethylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol.
| Compound Name | (1S)-3-[4-(cyclopropylmethylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 176644520 |
| Molecular Formula | C16H20F5N5O |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (1S)-3-[4-(cyclopropylmethylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol |
| SMILES | C[C@@H](Nc1nc(NCC2CC2)nc(C2=C(F)[C@@H](O)C(F)CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C16H20F5N5O/c1-7(16(19,20)21)23-15-25-13(9-4-5-10(17)12(27)11(9)18)24-14(26-15)22-6-8-2-3-8/h7-8,10,12,27H,2-6H2,1H3,(H2,22,23,24,25,26)/t7-,10?,12+/m1/s1 |
| InChIKey | OOHZIKISWWWSIZ-ATWGOZOYSA-N |
| XLogP | 3.23 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |