C17H20F7N5O — CID 176644513
(1S)-3-[4-[[(1R)-3,3-difluorocyclopentyl]amino]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol (PubChem CID 176644513) has the molecular formula C17H20F7N5O and a molecular weight of 443.37 g/mol. Its IUPAC name is (1S)-3-[4-[[(1R)-3,3-difluorocyclopentyl]amino]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol.
| Compound Name | (1S)-3-[4-[[(1R)-3,3-difluorocyclopentyl]amino]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 176644513 |
| Molecular Formula | C17H20F7N5O |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (1S)-3-[4-[[(1R)-3,3-difluorocyclopentyl]amino]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol |
| SMILES | C[C@@H](Nc1nc(N[C@@H]2CCC(F)(F)C2)nc(C2=C(F)[C@@H](O)C(F)CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C17H20F7N5O/c1-7(17(22,23)24)25-14-27-13(9-2-3-10(18)12(30)11(9)19)28-15(29-14)26-8-4-5-16(20,21)6-8/h7-8,10,12,30H,2-6H2,1H3,(H2,25,26,27,28,29)/t7-,8-,10?,12+/m1/s1 |
| InChIKey | GCDYFXDYDCJJSB-GQXZPPLKSA-N |
| XLogP | 4.01 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |