C17H18F7N5O — CID 138468951
(1R)-3-[4,6-bis[(3,3-difluorocyclobutyl)amino]-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol (PubChem CID 138468951) has the molecular formula C17H18F7N5O and a molecular weight of 441.35 g/mol. Its IUPAC name is (1R)-3-[4,6-bis[(3,3-difluorocyclobutyl)amino]-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol.
| Compound Name | (1R)-3-[4,6-bis[(3,3-difluorocyclobutyl)amino]-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 138468951 |
| Molecular Formula | C17H18F7N5O |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (1R)-3-[4,6-bis[(3,3-difluorocyclobutyl)amino]-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol |
| SMILES | O[C@@H]1C(F)=C(c2nc(NC3CC(F)(F)C3)nc(NC3CC(F)(F)C3)n2)CCC1(F)F |
| InChI | InChI=1S/C17H18F7N5O/c18-10-9(1-2-17(23,24)11(10)30)12-27-13(25-7-3-15(19,20)4-7)29-14(28-12)26-8-5-16(21,22)6-8/h7-8,11,30H,1-6H2,(H2,25,26,27,28,29)/t11-/m1/s1 |
| InChIKey | FLRNUZAJZVBORH-LLVKDONJSA-N |
| XLogP | 3.76 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |