C19H20F6N6O2 — CID 159014984
(1S)-1-deuterio-2,6,6-trifluoro-3-[4-[(2-methylpropan-2-yl)oxyamino]-6-[[2-(trifluoromethyl)-4-pyridinyl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol (PubChem CID 159014984) has the molecular formula C19H20F6N6O2 and a molecular weight of 479.40 g/mol. Its IUPAC name is (1S)-1-deuterio-2,6,6-trifluoro-3-[4-[(2-methylpropan-2-yl)oxyamino]-6-[[2-(trifluoromethyl)-4-pyridinyl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol.
| Compound Name | (1S)-1-deuterio-2,6,6-trifluoro-3-[4-[(2-methylpropan-2-yl)oxyamino]-6-[[2-(trifluoromethyl)-4-pyridinyl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 159014984 |
| Molecular Formula | C19H20F6N6O2 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (1S)-1-deuterio-2,6,6-trifluoro-3-[4-[(2-methylpropan-2-yl)oxyamino]-6-[[2-(trifluoromethyl)-4-pyridinyl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol |
| SMILES | [2H][C@]1(O)C(F)=C(c2nc(NOC(C)(C)C)nc(Nc3ccnc(C(F)(F)F)c3)n2)CCC1(F)F |
| InChI | InChI=1S/C19H20F6N6O2/c1-17(2,3)33-31-16-29-14(10-4-6-18(21,22)13(32)12(10)20)28-15(30-16)27-9-5-7-26-11(8-9)19(23,24)25/h5,7-8,13,32H,4,6H2,1-3H3,(H2,26,27,28,29,30,31)/t13-/m0/s1/i13D |
| InChIKey | PUHQUDLZZJEFIP-QWOGOBCGSA-N |
| XLogP | 4.64 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|