C12H14Cl2N6O — CID 138469118
6-chloro-4-N-(2-chloro-4-pyridinyl)-2-N-[(2-methylpropan-2-yl)oxy]-1,3,5-triazine-2,4-diamine (PubChem CID 138469118) has the molecular formula C12H14Cl2N6O and a molecular weight of 329.19 g/mol. Its IUPAC name is 6-chloro-4-N-(2-chloro-4-pyridinyl)-2-N-[(2-methylpropan-2-yl)oxy]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(2-chloro-4-pyridinyl)-2-N-[(2-methylpropan-2-yl)oxy]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 138469118 |
| Molecular Formula | C12H14Cl2N6O |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 6-chloro-4-N-(2-chloro-4-pyridinyl)-2-N-[(2-methylpropan-2-yl)oxy]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)ONc1nc(Cl)nc(Nc2ccnc(Cl)c2)n1 |
| InChI | InChI=1S/C12H14Cl2N6O/c1-12(2,3)21-20-11-18-9(14)17-10(19-11)16-7-4-5-15-8(13)6-7/h4-6H,1-3H3,(H2,15,16,17,18,19,20) |
| InChIKey | WPFHJGBRYINADD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|