C9H12Cl2N2O — CID 175445807
2,6-dichloro-N-[(2-methylpropan-2-yl)oxy]pyridin-4-amine (PubChem CID 175445807) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2-methylpropan-2-yl)oxy]pyridin-4-amine.
| Compound Name | 2,6-dichloro-N-[(2-methylpropan-2-yl)oxy]pyridin-4-amine |
|---|---|
| PubChem CID | 175445807 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2,6-dichloro-N-[(2-methylpropan-2-yl)oxy]pyridin-4-amine |
| SMILES | CC(C)(C)ONc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H12Cl2N2O/c1-9(2,3)14-13-6-4-7(10)12-8(11)5-6/h4-5H,1-3H3,(H,12,13) |
| InChIKey | CZRYNWQCRXXGPX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|