C15H15Cl2N — CID 170341950
4-(4-tert-butylphenyl)-2,6-dichloropyridine (PubChem CID 170341950) has the molecular formula C15H15Cl2N and a molecular weight of 280.20 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2,6-dichloropyridine.
| Compound Name | 4-(4-tert-butylphenyl)-2,6-dichloropyridine |
|---|---|
| PubChem CID | 170341950 |
| Molecular Formula | C15H15Cl2N |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2,6-dichloropyridine |
| SMILES | CC(C)(C)c1ccc(-c2cc(Cl)nc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H15Cl2N/c1-15(2,3)12-6-4-10(5-7-12)11-8-13(16)18-14(17)9-11/h4-9H,1-3H3 |
| InChIKey | DNFTYBLSQNAMKK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|