C12H19ClN2 — CID 130643026
2-chloro-N-(2,3,3-trimethylbutan-2-yl)pyridin-4-amine (PubChem CID 130643026) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 2-chloro-N-(2,3,3-trimethylbutan-2-yl)pyridin-4-amine.
| Compound Name | 2-chloro-N-(2,3,3-trimethylbutan-2-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 130643026 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-chloro-N-(2,3,3-trimethylbutan-2-yl)pyridin-4-amine |
| SMILES | CC(C)(C)C(C)(C)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H19ClN2/c1-11(2,3)12(4,5)15-9-6-7-14-10(13)8-9/h6-8H,1-5H3,(H,14,15) |
| InChIKey | BQCCQXSNTRCDGI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|