C11H17ClN2O — CID 130778820
3-[(2-chloro-4-pyridinyl)amino]-2-methylpentan-2-ol (PubChem CID 130778820) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)amino]-2-methylpentan-2-ol.
| Compound Name | 3-[(2-chloro-4-pyridinyl)amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 130778820 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)amino]-2-methylpentan-2-ol |
| SMILES | CCC(Nc1ccnc(Cl)c1)C(C)(C)O |
| InChI | InChI=1S/C11H17ClN2O/c1-4-9(11(2,3)15)14-8-5-6-13-10(12)7-8/h5-7,9,15H,4H2,1-3H3,(H,13,14) |
| InChIKey | WWUYJRUGZSEUBL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|