C10H15ClN2S — CID 103912505
2-chloro-N-(1-methylsulfanylbutan-2-yl)pyridin-4-amine (PubChem CID 103912505) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is 2-chloro-N-(1-methylsulfanylbutan-2-yl)pyridin-4-amine.
| Compound Name | 2-chloro-N-(1-methylsulfanylbutan-2-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 103912505 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-chloro-N-(1-methylsulfanylbutan-2-yl)pyridin-4-amine |
| SMILES | CCC(CSC)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H15ClN2S/c1-3-8(7-14-2)13-9-4-5-12-10(11)6-9/h4-6,8H,3,7H2,1-2H3,(H,12,13) |
| InChIKey | YQTFYTKANOGVOO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|