C14H15ClN6OS — CID 138469320
4-N-(1,2-benzothiazol-5-yl)-6-chloro-2-N-[(2-methylpropan-2-yl)oxy]-1,3,5-triazine-2,4-diamine (PubChem CID 138469320) has the molecular formula C14H15ClN6OS and a molecular weight of 350.84 g/mol. Its IUPAC name is 4-N-(1,2-benzothiazol-5-yl)-6-chloro-2-N-[(2-methylpropan-2-yl)oxy]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(1,2-benzothiazol-5-yl)-6-chloro-2-N-[(2-methylpropan-2-yl)oxy]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 138469320 |
| Molecular Formula | C14H15ClN6OS |
| Molecular Weight | 350.84 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-N-(1,2-benzothiazol-5-yl)-6-chloro-2-N-[(2-methylpropan-2-yl)oxy]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)ONc1nc(Cl)nc(Nc2ccc3sncc3c2)n1 |
| InChI | InChI=1S/C14H15ClN6OS/c1-14(2,3)22-21-13-19-11(15)18-12(20-13)17-9-4-5-10-8(6-9)7-16-23-10/h4-7H,1-3H3,(H2,17,18,19,20,21) |
| InChIKey | AEALTFAPSBVKBX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|