C14H19ClN6 — CID 20645289
4-N-(3-amino-4-methylphenyl)-2-N-tert-butyl-6-chloro-1,3,5-triazine-2,4-diamine (PubChem CID 20645289) has the molecular formula C14H19ClN6 and a molecular weight of 306.80 g/mol. Its IUPAC name is 4-N-(3-amino-4-methylphenyl)-2-N-tert-butyl-6-chloro-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3-amino-4-methylphenyl)-2-N-tert-butyl-6-chloro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 20645289 |
| Molecular Formula | C14H19ClN6 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-N-(3-amino-4-methylphenyl)-2-N-tert-butyl-6-chloro-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(Cl)nc(NC(C)(C)C)n2)cc1N |
| InChI | InChI=1S/C14H19ClN6/c1-8-5-6-9(7-10(8)16)17-12-18-11(15)19-13(20-12)21-14(2,3)4/h5-7H,16H2,1-4H3,(H2,17,18,19,20,21) |
| InChIKey | KBZWTRWDAAKESY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|