C12H12FN5 — CID 20645295
1-N-(4-ethenyl-6-fluoro-1,3,5-triazin-2-yl)-4-methylbenzene-1,3-diamine (PubChem CID 20645295) has the molecular formula C12H12FN5 and a molecular weight of 245.26 g/mol. Its IUPAC name is 1-N-(4-ethenyl-6-fluoro-1,3,5-triazin-2-yl)-4-methylbenzene-1,3-diamine.
| Compound Name | 1-N-(4-ethenyl-6-fluoro-1,3,5-triazin-2-yl)-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 20645295 |
| Molecular Formula | C12H12FN5 |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-N-(4-ethenyl-6-fluoro-1,3,5-triazin-2-yl)-4-methylbenzene-1,3-diamine |
| SMILES | C=Cc1nc(F)nc(Nc2ccc(C)c(N)c2)n1 |
| InChI | InChI=1S/C12H12FN5/c1-3-10-16-11(13)18-12(17-10)15-8-5-4-7(2)9(14)6-8/h3-6H,1,14H2,2H3,(H,15,16,17,18) |
| InChIKey | BFYBPRLHWVXANP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|