C11H10FN5O2S — CID 89345240
2-N-(4-ethenylsulfonylphenyl)-6-fluoro-1,3,5-triazine-2,4-diamine (PubChem CID 89345240) has the molecular formula C11H10FN5O2S and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-N-(4-ethenylsulfonylphenyl)-6-fluoro-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-ethenylsulfonylphenyl)-6-fluoro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 89345240 |
| Molecular Formula | C11H10FN5O2S |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-N-(4-ethenylsulfonylphenyl)-6-fluoro-1,3,5-triazine-2,4-diamine |
| SMILES | C=CS(=O)(=O)c1ccc(Nc2nc(N)nc(F)n2)cc1 |
| InChI | InChI=1S/C11H10FN5O2S/c1-2-20(18,19)8-5-3-7(4-6-8)14-11-16-9(12)15-10(13)17-11/h2-6H,1H2,(H3,13,14,15,16,17) |
| InChIKey | GYNGKPFKYHJSIY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |