C10H7BrCl2N4 — CID 55124610
N-(4-bromo-3-methylphenyl)-4,6-dichloro-1,3,5-triazin-2-amine (PubChem CID 55124610) has the molecular formula C10H7BrCl2N4 and a molecular weight of 334.00 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-4,6-dichloro-1,3,5-triazin-2-amine.
| Compound Name | N-(4-bromo-3-methylphenyl)-4,6-dichloro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 55124610 |
| Molecular Formula | C10H7BrCl2N4 |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-4,6-dichloro-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(Nc2nc(Cl)nc(Cl)n2)ccc1Br |
| InChI | InChI=1S/C10H7BrCl2N4/c1-5-4-6(2-3-7(5)11)14-10-16-8(12)15-9(13)17-10/h2-4H,1H3,(H,14,15,16,17) |
| InChIKey | USIUBWSVGTVBDG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |