C16H16F6N6S — CID 163436920
2-N,4-N-bis(3,3-difluorocyclobutyl)-6-[4-(difluoromethyl)-1-methylidene-1,3-thiazol-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 163436920) has the molecular formula C16H16F6N6S and a molecular weight of 438.40 g/mol. Its IUPAC name is 2-N,4-N-bis(3,3-difluorocyclobutyl)-6-[4-(difluoromethyl)-1-methylidene-1,3-thiazol-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3,3-difluorocyclobutyl)-6-[4-(difluoromethyl)-1-methylidene-1,3-thiazol-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 163436920 |
| Molecular Formula | C16H16F6N6S |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-N,4-N-bis(3,3-difluorocyclobutyl)-6-[4-(difluoromethyl)-1-methylidene-1,3-thiazol-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=S1C=C(C(F)F)N=C1c1nc(NC2CC(F)(F)C2)nc(NC2CC(F)(F)C2)n1 |
| InChI | InChI=1S/C16H16F6N6S/c1-29-6-9(10(17)18)25-12(29)11-26-13(23-7-2-15(19,20)3-7)28-14(27-11)24-8-4-16(21,22)5-8/h6-8,10H,1-5H2,(H2,23,24,26,27,28) |
| InChIKey | AVHBZNIMIICSGV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|