C10H14ClF2N5 — CID 161323439
6-chloro-4-N-(3,3-difluorocyclobutyl)-2-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 161323439) has the molecular formula C10H14ClF2N5 and a molecular weight of 284.75 g/mol. Its IUPAC name is 6-chloro-4-N-(3,3-difluorocyclobutyl)-2-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(3,3-difluorocyclobutyl)-2-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 161323439 |
| Molecular Formula | C10H14ClF2N5 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 6-chloro-4-N-(3,3-difluorocyclobutyl)-2-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | [2H]C([2H])([2H])C([2H])(Nc1nc(Cl)nc(NC2CC(F)(F)C2)n1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H14ClF2N5/c1-5(2)14-8-16-7(11)17-9(18-8)15-6-3-10(12,13)4-6/h5-6H,3-4H2,1-2H3,(H2,14,15,16,17,18)/i1D3,2D3,5D |
| InChIKey | VKLKMERPLIQJCY-TXVPSQRDSA-N |
| XLogP | 2.55 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |