C16H19F6N5O — CID 159330518
6,6-dideuterio-3-[4-[(3,3-difluorocyclobutyl)amino]-6-(1,1,1-trifluoropropan-2-ylamino)-1,3,5-triazin-2-yl]-2-fluorocyclohex-2-en-1-ol (PubChem CID 159330518) has the molecular formula C16H19F6N5O and a molecular weight of 413.36 g/mol. Its IUPAC name is 6,6-dideuterio-3-[4-[(3,3-difluorocyclobutyl)amino]-6-(1,1,1-trifluoropropan-2-ylamino)-1,3,5-triazin-2-yl]-2-fluorocyclohex-2-en-1-ol.
| Compound Name | 6,6-dideuterio-3-[4-[(3,3-difluorocyclobutyl)amino]-6-(1,1,1-trifluoropropan-2-ylamino)-1,3,5-triazin-2-yl]-2-fluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 159330518 |
| Molecular Formula | C16H19F6N5O |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 6,6-dideuterio-3-[4-[(3,3-difluorocyclobutyl)amino]-6-(1,1,1-trifluoropropan-2-ylamino)-1,3,5-triazin-2-yl]-2-fluorocyclohex-2-en-1-ol |
| SMILES | [2H]C1([2H])CCC(c2nc(NC3CC(F)(F)C3)nc(NC(C)C(F)(F)F)n2)=C(F)C1O |
| InChI | InChI=1S/C16H19F6N5O/c1-7(16(20,21)22)23-13-25-12(9-3-2-4-10(28)11(9)17)26-14(27-13)24-8-5-15(18,19)6-8/h7-8,10,28H,2-6H2,1H3,(H2,23,24,25,26,27)/i4D2 |
| InChIKey | GIFIEHBBQIEXOD-APZFVMQVSA-N |
| XLogP | 3.67 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |