C15H17F6N5O — CID 162445299
3-[4-(cyclopropylamino)-6-(1,1,1-trifluoropropan-2-ylamino)-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol (PubChem CID 162445299) has the molecular formula C15H17F6N5O and a molecular weight of 397.32 g/mol. Its IUPAC name is 3-[4-(cyclopropylamino)-6-(1,1,1-trifluoropropan-2-ylamino)-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol.
| Compound Name | 3-[4-(cyclopropylamino)-6-(1,1,1-trifluoropropan-2-ylamino)-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162445299 |
| Molecular Formula | C15H17F6N5O |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3-[4-(cyclopropylamino)-6-(1,1,1-trifluoropropan-2-ylamino)-1,3,5-triazin-2-yl]-2,6,6-trifluorocyclohex-2-en-1-ol |
| SMILES | CC(Nc1nc(NC2CC2)nc(C2=C(F)C(O)C(F)(F)CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C15H17F6N5O/c1-6(15(19,20)21)22-12-24-11(25-13(26-12)23-7-2-3-7)8-4-5-14(17,18)10(27)9(8)16/h6-7,10,27H,2-5H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | QGRYXCOXLAIVGT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |