C14H17F6N5O2 — CID 162611883
2,6,6-trifluoro-3-[4-(methoxyamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-1-methylcyclohex-2-en-1-ol (PubChem CID 162611883) has the molecular formula C14H17F6N5O2 and a molecular weight of 401.31 g/mol. Its IUPAC name is 2,6,6-trifluoro-3-[4-(methoxyamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-1-methylcyclohex-2-en-1-ol.
| Compound Name | 2,6,6-trifluoro-3-[4-(methoxyamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-1-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162611883 |
| Molecular Formula | C14H17F6N5O2 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2,6,6-trifluoro-3-[4-(methoxyamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-1-methylcyclohex-2-en-1-ol |
| SMILES | CONc1nc(N[C@H](C)C(F)(F)F)nc(C2=C(F)C(C)(O)C(F)(F)CC2)n1 |
| InChI | InChI=1S/C14H17F6N5O2/c1-6(14(18,19)20)21-10-22-9(23-11(24-10)25-27-3)7-4-5-13(16,17)12(2,26)8(7)15/h6,26H,4-5H2,1-3H3,(H2,21,22,23,24,25)/t6-,12?/m1/s1 |
| InChIKey | UHAJNUNNEJIECJ-ZJGHLTBISA-N |
| XLogP | 3.07 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|