C15H17F8N5O — CID 162445387
(1R)-3-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-1-deuterio-2,6-difluorocyclohex-2-en-1-ol (PubChem CID 162445387) has the molecular formula C15H17F8N5O and a molecular weight of 436.33 g/mol. Its IUPAC name is (1R)-3-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-1-deuterio-2,6-difluorocyclohex-2-en-1-ol.
| Compound Name | (1R)-3-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-1-deuterio-2,6-difluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162445387 |
| Molecular Formula | C15H17F8N5O |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (1R)-3-[4,6-bis[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-1-deuterio-2,6-difluorocyclohex-2-en-1-ol |
| SMILES | [2H][C@]1(O)C(F)=C(c2nc(N[C@H](C)C(F)(F)F)nc(N[C@H](C)C(F)(F)F)n2)CCC1F |
| InChI | InChI=1S/C15H17F8N5O/c1-5(14(18,19)20)24-12-26-11(7-3-4-8(16)10(29)9(7)17)27-13(28-12)25-6(2)15(21,22)23/h5-6,8,10,29H,3-4H2,1-2H3,(H2,24,25,26,27,28)/t5-,6-,8?,10-/m1/s1/i10D |
| InChIKey | MBCYVKFRCILUQS-SLHNMNKRSA-N |
| XLogP | 3.77 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |