C12H10ClF5N4O — CID 162483940
3-[4-chloro-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-one (PubChem CID 162483940) has the molecular formula C12H10ClF5N4O and a molecular weight of 356.68 g/mol. Its IUPAC name is 3-[4-chloro-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-one.
| Compound Name | 3-[4-chloro-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162483940 |
| Molecular Formula | C12H10ClF5N4O |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 3-[4-chloro-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-one |
| SMILES | C[C@@H](Nc1nc(Cl)nc(C2=C(F)C(=O)C(F)CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF5N4O/c1-4(12(16,17)18)19-11-21-9(20-10(13)22-11)5-2-3-6(14)8(23)7(5)15/h4,6H,2-3H2,1H3,(H,19,20,21,22)/t4-,6?/m1/s1 |
| InChIKey | UGHKNRABOMCJBS-NJXYFUOMSA-N |
| XLogP | 3.27 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|