C17H19F7N4O — CID 138469327
2-fluoro-3-[4-[(3S)-4,4,4-trifluoro-3-methylbutyl]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-one (PubChem CID 138469327) has the molecular formula C17H19F7N4O and a molecular weight of 428.35 g/mol. Its IUPAC name is 2-fluoro-3-[4-[(3S)-4,4,4-trifluoro-3-methylbutyl]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-one.
| Compound Name | 2-fluoro-3-[4-[(3S)-4,4,4-trifluoro-3-methylbutyl]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 138469327 |
| Molecular Formula | C17H19F7N4O |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-fluoro-3-[4-[(3S)-4,4,4-trifluoro-3-methylbutyl]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-one |
| SMILES | C[C@@H](CCc1nc(N[C@H](C)C(F)(F)F)nc(C2=C(F)C(=O)CCC2)n1)C(F)(F)F |
| InChI | InChI=1S/C17H19F7N4O/c1-8(16(19,20)21)6-7-12-26-14(10-4-3-5-11(29)13(10)18)28-15(27-12)25-9(2)17(22,23)24/h8-9H,3-7H2,1-2H3,(H,25,26,27,28)/t8-,9+/m0/s1 |
| InChIKey | ULZAXFLZUPBHBM-DTWKUNHWSA-N |
| XLogP | 4.80 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|