C14H20FN5O — CID 166860057
3-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-2-fluorocyclohex-2-en-1-one (PubChem CID 166860057) has the molecular formula C14H20FN5O and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-2-fluorocyclohex-2-en-1-one.
| Compound Name | 3-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-2-fluorocyclohex-2-en-1-one |
|---|---|
| PubChem CID | 166860057 |
| Molecular Formula | C14H20FN5O |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-2-fluorocyclohex-2-en-1-one |
| SMILES | CCNc1nc(NC(C)C)nc(C2=C(F)C(=O)CCC2)n1 |
| InChI | InChI=1S/C14H20FN5O/c1-4-16-13-18-12(19-14(20-13)17-8(2)3)9-6-5-7-10(21)11(9)15/h8H,4-7H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | FQSQNCXIUXOHJY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|