C9H18N6O — CID 90175544
N-[4-(propan-2-ylamino)-6-(propylamino)-1,3,5-triazin-2-yl]hydroxylamine (PubChem CID 90175544) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is N-[4-(propan-2-ylamino)-6-(propylamino)-1,3,5-triazin-2-yl]hydroxylamine.
| Compound Name | N-[4-(propan-2-ylamino)-6-(propylamino)-1,3,5-triazin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 90175544 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-[4-(propan-2-ylamino)-6-(propylamino)-1,3,5-triazin-2-yl]hydroxylamine |
| SMILES | CCCNc1nc(NO)nc(NC(C)C)n1 |
| InChI | InChI=1S/C9H18N6O/c1-4-5-10-7-12-8(11-6(2)3)14-9(13-7)15-16/h6,16H,4-5H2,1-3H3,(H3,10,11,12,13,14,15) |
| InChIKey | VHTXEHNOKQVSEK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|