C14H20F3N5 — CID 162445328
6-(cyclopenten-1-yl)-4-N-propan-2-yl-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 162445328) has the molecular formula C14H20F3N5 and a molecular weight of 315.34 g/mol. Its IUPAC name is 6-(cyclopenten-1-yl)-4-N-propan-2-yl-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(cyclopenten-1-yl)-4-N-propan-2-yl-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 162445328 |
| Molecular Formula | C14H20F3N5 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 6-(cyclopenten-1-yl)-4-N-propan-2-yl-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Nc1nc(N[C@H](C)C(F)(F)F)nc(C2=CCCC2)n1 |
| InChI | InChI=1S/C14H20F3N5/c1-8(2)18-12-20-11(10-6-4-5-7-10)21-13(22-12)19-9(3)14(15,16)17/h6,8-9H,4-5,7H2,1-3H3,(H2,18,19,20,21,22)/t9-/m1/s1 |
| InChIKey | PODLLJSGIUWPAB-SECBINFHSA-N |
| XLogP | 3.62 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |