C14H16ClF3N6 — CID 160677400
6-(6-chloro-3,4-dideuterio-2-pyridinyl)-4-N-propan-2-yl-2-N-[(2R)-1,1,1-trideuterio-3,3,3-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 160677400) has the molecular formula C14H16ClF3N6 and a molecular weight of 365.80 g/mol. Its IUPAC name is 6-(6-chloro-3,4-dideuterio-2-pyridinyl)-4-N-propan-2-yl-2-N-[(2R)-1,1,1-trideuterio-3,3,3-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-chloro-3,4-dideuterio-2-pyridinyl)-4-N-propan-2-yl-2-N-[(2R)-1,1,1-trideuterio-3,3,3-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 160677400 |
| Molecular Formula | C14H16ClF3N6 |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 6-(6-chloro-3,4-dideuterio-2-pyridinyl)-4-N-propan-2-yl-2-N-[(2R)-1,1,1-trideuterio-3,3,3-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | [2H]c1cc(Cl)nc(-c2nc(NC(C)C)nc(N[C@H](C([2H])([2H])[2H])C(F)(F)F)n2)c1[2H] |
| InChI | InChI=1S/C14H16ClF3N6/c1-7(2)19-12-22-11(9-5-4-6-10(15)21-9)23-13(24-12)20-8(3)14(16,17)18/h4-8H,1-3H3,(H2,19,20,22,23,24)/t8-/m1/s1/i3D3,4D,5D |
| InChIKey | RNRZVAYHMLFMHU-LDNCHGHBSA-N |
| XLogP | 3.77 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|