C15H21F4N5O — CID 162445372
1-deuterio-2-fluoro-3-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol (PubChem CID 162445372) has the molecular formula C15H21F4N5O and a molecular weight of 371.41 g/mol. Its IUPAC name is 1-deuterio-2-fluoro-3-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol.
| Compound Name | 1-deuterio-2-fluoro-3-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162445372 |
| Molecular Formula | C15H21F4N5O |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-deuterio-2-fluoro-3-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol |
| SMILES | [2H]C1(O)CCCC(c2nc(N[C@H](C)C(F)(F)F)nc(NC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])n2)=C1F |
| InChI | InChI=1S/C15H21F4N5O/c1-7(2)20-13-22-12(9-5-4-6-10(25)11(9)16)23-14(24-13)21-8(3)15(17,18)19/h7-8,10,25H,4-6H2,1-3H3,(H2,20,21,22,23,24)/t8-,10?/m1/s1/i1D3,2D3,7D,10D |
| InChIKey | HDZKBJFSOSEMGY-PMEXDQKUSA-N |
| XLogP | 3.28 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |