C15H14F9N5O — CID 166860252
2,6,6-trifluoro-3-[4-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-6-(3,3,3-trifluoroprop-1-en-2-ylamino)-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol (PubChem CID 166860252) has the molecular formula C15H14F9N5O and a molecular weight of 451.29 g/mol. Its IUPAC name is 2,6,6-trifluoro-3-[4-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-6-(3,3,3-trifluoroprop-1-en-2-ylamino)-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol.
| Compound Name | 2,6,6-trifluoro-3-[4-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-6-(3,3,3-trifluoroprop-1-en-2-ylamino)-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 166860252 |
| Molecular Formula | C15H14F9N5O |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2,6,6-trifluoro-3-[4-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-6-(3,3,3-trifluoroprop-1-en-2-ylamino)-1,3,5-triazin-2-yl]cyclohex-2-en-1-ol |
| SMILES | C=C(Nc1nc(N[C@@H](C)C(F)(F)F)nc(C2=C(F)C(O)C(F)(F)CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C15H14F9N5O/c1-5(14(19,20)21)25-11-27-10(7-3-4-13(17,18)9(30)8(7)16)28-12(29-11)26-6(2)15(22,23)24/h6,9,30H,1,3-4H2,2H3,(H2,25,26,27,28,29)/t6-,9?/m0/s1 |
| InChIKey | KLAYNJDMLSWZHM-AADKRJSRSA-N |
| XLogP | 4.19 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |