About CID 59482340
CID 59482340 (PubChem CID 59482340) has the molecular formula C21H36FN7O2
and a molecular weight of 437.56 g/mol.
Molecular Properties
| Compound Name | CID 59482340 |
| PubChem CID | 59482340 |
| Molecular Formula | C21H36FN7O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(Nc2nc(F)nc(NC3CC(C)(C)N([O])C(C)(C)C3)n2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C21H36FN7O2/c1-18(2)9-13(10-19(3,4)28(18)30)23-16-25-15(22)26-17(27-16)24-14-11-20(5,6)29(31)21(7,8)12-14/h13-14H,9-12H2,1-8H3,(H2,23,24,25,26,27) |
| InChIKey | UIDUTLNRSDKRQV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 59482340 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59482340?
The IUPAC name of CID 59482340 (CID 59482340) is not available.
What is the SMILES notation for CID 59482340?
The canonical SMILES for CID 59482340 is CC1(C)CC(Nc2nc(F)nc(NC3CC(C)(C)N([O])C(C)(C)C3)n2)CC(C)(C)N1[O].
What is the InChIKey of CID 59482340?
The InChIKey is UIDUTLNRSDKRQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36FN7O2/c1-18(2)9-13(10-19(3,4)28(18)30)23-16-25-15(22)26-17(27-16)24-14-11-20(5,6)29(31)21(7,8)12-14/h13-14H,9-12H2,1-8H3,(H2,23,24,25,26,27).
What are the key properties of CID 59482340?
CID 59482340 has a molecular weight of 437.56 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59482340 is sourced from PubChem (CID 59482340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).