C21H36FN7O2 — CID 59482340
CID 59482340 (PubChem CID 59482340) has the molecular formula C21H36FN7O2 and a molecular weight of 437.56 g/mol.
| Compound Name | CID 59482340 |
|---|---|
| PubChem CID | 59482340 |
| Molecular Formula | C21H36FN7O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(Nc2nc(F)nc(NC3CC(C)(C)N([O])C(C)(C)C3)n2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C21H36FN7O2/c1-18(2)9-13(10-19(3,4)28(18)30)23-16-25-15(22)26-17(27-16)24-14-11-20(5,6)29(31)21(7,8)12-14/h13-14H,9-12H2,1-8H3,(H2,23,24,25,26,27) |
| InChIKey | UIDUTLNRSDKRQV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |