C29H54ClN7 — CID 11699446
N-butyl-1-[4-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]-6-chloro-1,3,5-triazin-2-yl]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 11699446) has the molecular formula C29H54ClN7 and a molecular weight of 536.25 g/mol. Its IUPAC name is N-butyl-1-[4-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]-6-chloro-1,3,5-triazin-2-yl]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-butyl-1-[4-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]-6-chloro-1,3,5-triazin-2-yl]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 11699446 |
| Molecular Formula | C29H54ClN7 |
| Molecular Weight | 536.25 g/mol |
| Exact Mass | 535.41 |
| IUPAC Name | N-butyl-1-[4-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]-6-chloro-1,3,5-triazin-2-yl]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CCCCNC1CC(C)(C)N(c2nc(Cl)nc(N3C(C)(C)CC(NCCCC)CC3(C)C)n2)C(C)(C)C1 |
| InChI | InChI=1S/C29H54ClN7/c1-11-13-15-31-21-17-26(3,4)36(27(5,6)18-21)24-33-23(30)34-25(35-24)37-28(7,8)19-22(20-29(37,9)10)32-16-14-12-2/h21-22,31-32H,11-20H2,1-10H3 |
| InChIKey | DARUEKWVLGHJJT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.25 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|