C35H66N8 — CID 91982043
2,9-bis(2,2,6,6-tetramethylpiperidin-4-yl)-N-(2,4,4-trimethylpentan-2-yl)-2,9,11,13,14-pentazabicyclo[8.3.1]tetradeca-1(14),10,12-trien-12-amine (PubChem CID 91982043) has the molecular formula C35H66N8 and a molecular weight of 598.97 g/mol. Its IUPAC name is 2,9-bis(2,2,6,6-tetramethylpiperidin-4-yl)-N-(2,4,4-trimethylpentan-2-yl)-2,9,11,13,14-pentazabicyclo[8.3.1]tetradeca-1(14),10,12-trien-12-amine.
| Compound Name | 2,9-bis(2,2,6,6-tetramethylpiperidin-4-yl)-N-(2,4,4-trimethylpentan-2-yl)-2,9,11,13,14-pentazabicyclo[8.3.1]tetradeca-1(14),10,12-trien-12-amine |
|---|---|
| PubChem CID | 91982043 |
| Molecular Formula | C35H66N8 |
| Molecular Weight | 598.97 g/mol |
| Exact Mass | 598.54 |
| IUPAC Name | 2,9-bis(2,2,6,6-tetramethylpiperidin-4-yl)-N-(2,4,4-trimethylpentan-2-yl)-2,9,11,13,14-pentazabicyclo[8.3.1]tetradeca-1(14),10,12-trien-12-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1nc2nc(n1)N(C1CC(C)(C)NC(C)(C)C1)CCCCCCN2C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C35H66N8/c1-30(2,3)24-35(12,13)39-27-36-28-38-29(37-27)43(26-22-33(8,9)41-34(10,11)23-26)19-17-15-14-16-18-42(28)25-20-31(4,5)40-32(6,7)21-25/h25-26,40-41H,14-24H2,1-13H3,(H,36,37,38,39) |
| InChIKey | YYZMHKLNUJLKSX-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.97 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |