C35H66N8 — CID 118030570
2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 118030570) has the molecular formula C35H66N8 and a molecular weight of 598.97 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 118030570 |
| Molecular Formula | C35H66N8 |
| Molecular Weight | 598.97 g/mol |
| Exact Mass | 598.54 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCN(c1nc(N2CCCC2)nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)n1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C35H66N8/c1-13-15-21-42(27-23-32(3,4)39(11)33(5,6)24-27)30-36-29(41-19-17-18-20-41)37-31(38-30)43(22-16-14-2)28-25-34(7,8)40(12)35(9,10)26-28/h27-28H,13-26H2,1-12H3 |
| InChIKey | TWRXLSBOPJJNHZ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 54.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.97 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |