C19H21N7O2 — CID 45270415
3-amino-N-(diaminomethylidene)-6-(furan-3-yl)-5-(3-phenylpropylamino)pyrazine-2-carboxamide (PubChem CID 45270415) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-amino-N-(diaminomethylidene)-6-(furan-3-yl)-5-(3-phenylpropylamino)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-(diaminomethylidene)-6-(furan-3-yl)-5-(3-phenylpropylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 45270415 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-amino-N-(diaminomethylidene)-6-(furan-3-yl)-5-(3-phenylpropylamino)pyrazine-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1nc(-c2ccoc2)c(NCCCc2ccccc2)nc1N |
| InChI | InChI=1S/C19H21N7O2/c20-16-15(18(27)26-19(21)22)24-14(13-8-10-28-11-13)17(25-16)23-9-4-7-12-5-2-1-3-6-12/h1-3,5-6,8,10-11H,4,7,9H2,(H3,20,23,25)(H4,21,22,26,27) |
| InChIKey | NJRUWTPSRHAWQB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|