C10H11FN2O4S — CID 60708678
N-(4-fluoro-3-nitrophenyl)-1,1-dioxothiolan-3-amine (PubChem CID 60708678) has the molecular formula C10H11FN2O4S and a molecular weight of 274.27 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 60708678 |
| Molecular Formula | C10H11FN2O4S |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-1,1-dioxothiolan-3-amine |
| SMILES | O=[N+]([O-])c1cc(NC2CCS(=O)(=O)C2)ccc1F |
| InChI | InChI=1S/C10H11FN2O4S/c11-9-2-1-7(5-10(9)13(14)15)12-8-3-4-18(16,17)6-8/h1-2,5,8,12H,3-4,6H2 |
| InChIKey | CKGJRIUEXMSZKG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|