C11H13BrN2O4S — CID 79767753
N-(4-bromo-3-nitrophenyl)-1,1-dioxothian-3-amine (PubChem CID 79767753) has the molecular formula C11H13BrN2O4S and a molecular weight of 349.21 g/mol. Its IUPAC name is N-(4-bromo-3-nitrophenyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(4-bromo-3-nitrophenyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 79767753 |
| Molecular Formula | C11H13BrN2O4S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | N-(4-bromo-3-nitrophenyl)-1,1-dioxothian-3-amine |
| SMILES | O=[N+]([O-])c1cc(NC2CCCS(=O)(=O)C2)ccc1Br |
| InChI | InChI=1S/C11H13BrN2O4S/c12-10-4-3-8(6-11(10)14(15)16)13-9-2-1-5-19(17,18)7-9/h3-4,6,9,13H,1-2,5,7H2 |
| InChIKey | YVVVDIRHLYVWOZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|