C11H16N4O4S — CID 80912856
N-(3-hydrazinyl-5-nitrophenyl)-1,1-dioxothian-3-amine (PubChem CID 80912856) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(3-hydrazinyl-5-nitrophenyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(3-hydrazinyl-5-nitrophenyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 80912856 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-(3-hydrazinyl-5-nitrophenyl)-1,1-dioxothian-3-amine |
| SMILES | NNc1cc(NC2CCCS(=O)(=O)C2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H16N4O4S/c12-14-10-4-9(5-11(6-10)15(16)17)13-8-2-1-3-20(18,19)7-8/h4-6,8,13-14H,1-3,7,12H2 |
| InChIKey | RPYQIRPYFOAREV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|