C13H18N2O5S — CID 81144605
N-[(3-methoxy-5-nitrophenyl)methyl]-1,1-dioxothian-3-amine (PubChem CID 81144605) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is N-[(3-methoxy-5-nitrophenyl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(3-methoxy-5-nitrophenyl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 81144605 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[(3-methoxy-5-nitrophenyl)methyl]-1,1-dioxothian-3-amine |
| SMILES | COc1cc(CNC2CCCS(=O)(=O)C2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18N2O5S/c1-20-13-6-10(5-12(7-13)15(16)17)8-14-11-3-2-4-21(18,19)9-11/h5-7,11,14H,2-4,8-9H2,1H3 |
| InChIKey | KKLPBCOTPAFFFS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|