C16H19N3O6 — CID 9287779
[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl] (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 9287779) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl] (E)-3-(2-nitrophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9287779 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | CC(C)NC(=O)CNC(=O)COC(=O)/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O6/c1-11(2)18-14(20)9-17-15(21)10-25-16(22)8-7-12-5-3-4-6-13(12)19(23)24/h3-8,11H,9-10H2,1-2H3,(H,17,21)(H,18,20)/b8-7+ |
| InChIKey | XTWDWWKYGXURHT-BQYQJAHWSA-N |
| XLogP | 0.79 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|