C28H28O3S — CID 25425940
[2-(4-cyclohexylphenyl)-2-oxoethyl] (2R)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 25425940) has the molecular formula C28H28O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] (2R)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] (2R)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 25425940 |
| Molecular Formula | C28H28O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] (2R)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | O=C(COC(=O)[C@H](Sc1ccccc1)c1ccccc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H28O3S/c29-26(23-18-16-22(17-19-23)21-10-4-1-5-11-21)20-31-28(30)27(24-12-6-2-7-13-24)32-25-14-8-3-9-15-25/h2-3,6-9,12-19,21,27H,1,4-5,10-11,20H2/t27-/m1/s1 |
| InChIKey | PKAZYPKWKYZJHA-HHHXNRCGSA-N |
| XLogP | 6.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |