C26H31NO5 — CID 126009230
[2-(4-cyclohexylphenyl)-2-oxoethyl] (3S)-3-(ethoxycarbonylamino)-3-phenylpropanoate (PubChem CID 126009230) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] (3S)-3-(ethoxycarbonylamino)-3-phenylpropanoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] (3S)-3-(ethoxycarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 126009230 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] (3S)-3-(ethoxycarbonylamino)-3-phenylpropanoate |
| SMILES | CCOC(=O)N[C@@H](CC(=O)OCC(=O)c1ccc(C2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H31NO5/c1-2-31-26(30)27-23(21-11-7-4-8-12-21)17-25(29)32-18-24(28)22-15-13-20(14-16-22)19-9-5-3-6-10-19/h4,7-8,11-16,19,23H,2-3,5-6,9-10,17-18H2,1H3,(H,27,30)/t23-/m0/s1 |
| InChIKey | ORQIDQJXBUQLRK-QHCPKHFHSA-N |
| XLogP | 5.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |