C19H10N4O2S4 — CID 3391492
2-[[6-(1,3-benzothiazol-2-ylsulfanyl)-5-nitro-2-pyridinyl]sulfanyl]-1,3-benzothiazole (PubChem CID 3391492) has the molecular formula C19H10N4O2S4 and a molecular weight of 454.58 g/mol. Its IUPAC name is 2-[[6-(1,3-benzothiazol-2-ylsulfanyl)-5-nitro-2-pyridinyl]sulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[6-(1,3-benzothiazol-2-ylsulfanyl)-5-nitro-2-pyridinyl]sulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3391492 |
| Molecular Formula | C19H10N4O2S4 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 2-[[6-(1,3-benzothiazol-2-ylsulfanyl)-5-nitro-2-pyridinyl]sulfanyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(Sc2nc3ccccc3s2)nc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H10N4O2S4/c24-23(25)13-9-10-16(28-18-20-11-5-1-3-7-14(11)26-18)22-17(13)29-19-21-12-6-2-4-8-15(12)27-19/h1-10H |
| InChIKey | IARGWGJNGUBKNY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|