C13H10ClN3O3S2 — CID 110184394
2-(6-methoxy-3-nitropyridin-1-ium-2-yl)sulfanyl-1,3-benzothiazole chloride (PubChem CID 110184394) has the molecular formula C13H10ClN3O3S2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 2-(6-methoxy-3-nitropyridin-1-ium-2-yl)sulfanyl-1,3-benzothiazole chloride.
| Compound Name | 2-(6-methoxy-3-nitropyridin-1-ium-2-yl)sulfanyl-1,3-benzothiazole chloride |
|---|---|
| PubChem CID | 110184394 |
| Molecular Formula | C13H10ClN3O3S2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 2-(6-methoxy-3-nitropyridin-1-ium-2-yl)sulfanyl-1,3-benzothiazole chloride |
| SMILES | COc1ccc([N+](=O)[O-])c(Sc2nc3ccccc3s2)[nH+]1.[Cl-] |
| InChI | InChI=1S/C13H9N3O3S2.ClH/c1-19-11-7-6-9(16(17)18)12(15-11)21-13-14-8-4-2-3-5-10(8)20-13;/h2-7H,1H3;1H |
| InChIKey | IQJQWHUPXVPTFC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 79.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|