C21H19N5O2S2 — CID 110173598
2-N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]-6-N-benzyl-3-nitropyridine-2,6-diamine (PubChem CID 110173598) has the molecular formula C21H19N5O2S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 2-N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]-6-N-benzyl-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]-6-N-benzyl-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 110173598 |
| Molecular Formula | C21H19N5O2S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]-6-N-benzyl-3-nitropyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccccc2)nc1NCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H19N5O2S2/c27-26(28)17-10-11-19(23-14-15-6-2-1-3-7-15)25-20(17)22-12-13-29-21-24-16-8-4-5-9-18(16)30-21/h1-11H,12-14H2,(H2,22,23,25) |
| InChIKey | HDBNZVQCZFNBAI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|