C13H5N5O6S2 — CID 122197338
4-(1,3-benzothiazol-2-ylsulfanyl)-5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium (PubChem CID 122197338) has the molecular formula C13H5N5O6S2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium |
|---|---|
| PubChem CID | 122197338 |
| Molecular Formula | C13H5N5O6S2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-5,7-dinitro-3-oxido-2,1,3-benzoxadiazol-3-ium |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2no[n+]([O-])c2c1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H5N5O6S2/c19-16(20)7-5-8(17(21)22)12(11-10(7)15-24-18(11)23)26-13-14-6-3-1-2-4-9(6)25-13/h1-5H |
| InChIKey | XRCRHDAZUPRPOR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 152.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|