C20H14N2O2S2 — CID 126201697
2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]-1,3-benzothiazole (PubChem CID 126201697) has the molecular formula C20H14N2O2S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 126201697 |
| Molecular Formula | C20H14N2O2S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]-1,3-benzothiazole |
| SMILES | Cc1ccc(Sc2ccc(-c3nc4ccccc4s3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H14N2O2S2/c1-13-6-9-15(10-7-13)25-19-11-8-14(12-17(19)22(23)24)20-21-16-4-2-3-5-18(16)26-20/h2-12H,1H3 |
| InChIKey | VBBOCVYIMRPJAY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|