C25H18N2O4S — CID 6216959
2-[(E)-2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]ethenyl]quinoline-4-carboxylic acid (PubChem CID 6216959) has the molecular formula C25H18N2O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[(E)-2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]ethenyl]quinoline-4-carboxylic acid.
| Compound Name | 2-[(E)-2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]ethenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 6216959 |
| Molecular Formula | C25H18N2O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 2-[(E)-2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]ethenyl]quinoline-4-carboxylic acid |
| SMILES | Cc1ccc(Sc2ccc(/C=C/c3cc(C(=O)O)c4ccccc4n3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H18N2O4S/c1-16-6-11-19(12-7-16)32-24-13-9-17(14-23(24)27(30)31)8-10-18-15-21(25(28)29)20-4-2-3-5-22(20)26-18/h2-15H,1H3,(H,28,29)/b10-8+ |
| InChIKey | PAPWNZOKTLBXAE-CSKARUKUSA-N |
| XLogP | 6.47 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|