C16H15NO2S3 — CID 2747654
2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]-1,3-dithiolane (PubChem CID 2747654) has the molecular formula C16H15NO2S3 and a molecular weight of 349.50 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]-1,3-dithiolane.
| Compound Name | 2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 2747654 |
| Molecular Formula | C16H15NO2S3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]-1,3-dithiolane |
| SMILES | Cc1ccc(Sc2ccc(C3SCCS3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15NO2S3/c1-11-2-5-13(6-3-11)22-15-7-4-12(10-14(15)17(18)19)16-20-8-9-21-16/h2-7,10,16H,8-9H2,1H3 |
| InChIKey | FLWOCNHGYQGUGY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|